| Name | (R)-(-)-propylene glycol |
| Synonyms | (R)-(-)-PROPANEDIOL (R)-1,2-PROPANEDIOL (R)-1,2-Propanediol (R)-propane-1,2-diol (2R)-PROPANE-1,2-DIOL (R)-(-)-1,2-Propanediol (R)-(-)-1,2-PROPANEDIOL (R)-(-)-propylene glycol (R)-(-)-PROPYLENE GLYCOL (R)-(-)-PROPYLENE GLYCEROL (R)-(-)-1,2-Propyleneglycol |
| CAS | 4254-14-2 |
| InChI | InChI=1/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m1/s1 |
| Molecular Formula | C3H8O2 |
| Molar Mass | 76.09 |
| Density | 1.04g/mLat 25°C(lit.) |
| Melting Point | -57C |
| Boling Point | 186-188°C765mm Hg(lit.) |
| Specific Rotation(α) | -17 º (c=neat) |
| Flash Point | 225°F |
| Solubility | Miscible with acetone, chloroform, ethanol (95%),glycerin, and water; soluble at 1 in 6 parts of ether; not misciblewith light mineral oil or fixed oils, but will dissolve someessential oils. |
| Vapor Presure | 0.204mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.036 |
| Color | Colorless to Light orange to Yellow |
| Merck | 14,7855 |
| BRN | 1718872 |
| pKa | 14.49±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Hygroscopic |
| Refractive Index | n20/D 1.434(lit.) |
| Physical and Chemical Properties | Density 1.04 boiling point 187°C refractive index 1.431-1.433 flash point 107°C specific optical rotation -17 ° (c = neat) |
| Risk Codes | R20 - Harmful by inhalation R65 - Harmful: May cause lung damage if swallowed R15 - Contact with water liberates extremely flammable gases R10 - Flammable |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S43 - In case of fire use ... (there follows the type of fire-fighting equipment to be used.) S7/8 - |
| WGK Germany | 1 |
| FLUKA BRAND F CODES | 3 |
| HS Code | 29053200 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| use | pharmaceutical intermediates |
| Biological activity | (R)-(-)-1,2-Propanediol is the (R)-enantiomer of 1,2-Propanediol, which is produced from Escherichia coli expressing the NADH-linked glycerol dehydrogenase gene. |